C25H48O2Si2 — CID 134940845
triethyl-[[(3R,6R)-3-[(1R)-1-triethylsilyloxyethyl]-1,2,3,4,5,6-hexahydroazulen-6-yl]methoxy]silane (PubChem CID 134940845) has the molecular formula C25H48O2Si2 and a molecular weight of 436.83 g/mol. Its IUPAC name is triethyl-[[(3R,6R)-3-[(1R)-1-triethylsilyloxyethyl]-1,2,3,4,5,6-hexahydroazulen-6-yl]methoxy]silane.
| Compound Name | triethyl-[[(3R,6R)-3-[(1R)-1-triethylsilyloxyethyl]-1,2,3,4,5,6-hexahydroazulen-6-yl]methoxy]silane |
|---|---|
| PubChem CID | 134940845 |
| Molecular Formula | C25H48O2Si2 |
| Molecular Weight | 436.83 g/mol |
| Exact Mass | 436.32 |
| IUPAC Name | triethyl-[[(3R,6R)-3-[(1R)-1-triethylsilyloxyethyl]-1,2,3,4,5,6-hexahydroazulen-6-yl]methoxy]silane |
| SMILES | CC[Si](CC)(CC)OC[C@H]1C=CC2=C(CC1)[C@H]([C@@H](C)O[Si](CC)(CC)CC)CC2 |
| InChI | InChI=1S/C25H48O2Si2/c1-8-28(9-2,10-3)26-20-22-14-16-23-17-19-24(25(23)18-15-22)21(7)27-29(11-4,12-5)13-6/h14,16,21-22,24H,8-13,15,17-20H2,1-7H3/t21-,22+,24+/m1/s1 |
| InChIKey | GANCDHNWLXOEBF-GPXNEJASSA-N |
| XLogP | 8.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.83 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|