C23H42OSi — CID 135014361
[(1R,5S)-6-butyl-5-methyl-2,3,4,5-tetrahydro-1H-inden-1-yl]oxy-tri(propan-2-yl)silane (PubChem CID 135014361) has the molecular formula C23H42OSi and a molecular weight of 362.67 g/mol. Its IUPAC name is [(1R,5S)-6-butyl-5-methyl-2,3,4,5-tetrahydro-1H-inden-1-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(1R,5S)-6-butyl-5-methyl-2,3,4,5-tetrahydro-1H-inden-1-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 135014361 |
| Molecular Formula | C23H42OSi |
| Molecular Weight | 362.67 g/mol |
| Exact Mass | 362.30 |
| IUPAC Name | [(1R,5S)-6-butyl-5-methyl-2,3,4,5-tetrahydro-1H-inden-1-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CCCCC1=CC2=C(CC[C@H]2O[Si](C(C)C)(C(C)C)C(C)C)C[C@@H]1C |
| InChI | InChI=1S/C23H42OSi/c1-9-10-11-20-15-22-21(14-19(20)8)12-13-23(22)24-25(16(2)3,17(4)5)18(6)7/h15-19,23H,9-14H2,1-8H3/t19-,23+/m0/s1 |
| InChIKey | GNAGHIWZWPCHBL-WMZHIEFXSA-N |
| XLogP | 7.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.67 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|