C21H36OSi — CID 134983137
tert-butyl-[(3Z,7E,9S)-2,6-dimethylidene-9-propan-2-ylcyclodeca-3,7-dien-1-yl]oxy-dimethylsilane (PubChem CID 134983137) has the molecular formula C21H36OSi and a molecular weight of 332.60 g/mol. Its IUPAC name is tert-butyl-[(3Z,7E,9S)-2,6-dimethylidene-9-propan-2-ylcyclodeca-3,7-dien-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3Z,7E,9S)-2,6-dimethylidene-9-propan-2-ylcyclodeca-3,7-dien-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134983137 |
| Molecular Formula | C21H36OSi |
| Molecular Weight | 332.60 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | tert-butyl-[(3Z,7E,9S)-2,6-dimethylidene-9-propan-2-ylcyclodeca-3,7-dien-1-yl]oxy-dimethylsilane |
| SMILES | C=C1/C=C/[C@H](C(C)C)CC(O[Si](C)(C)C(C)(C)C)C(=C)/C=C\C1 |
| InChI | InChI=1S/C21H36OSi/c1-16(2)19-14-13-17(3)11-10-12-18(4)20(15-19)22-23(8,9)21(5,6)7/h10,12-14,16,19-20H,3-4,11,15H2,1-2,5-9H3/b12-10-,14-13+/t19-,20?/m0/s1 |
| InChIKey | HLPDUABNRALOCW-AUMXREBGSA-N |
| XLogP | 6.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.60 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|