C18H30OSi — CID 162406242
[(3aR,4S)-7-ethenyl-2,3,3a,4,5,6-hexahydroazulen-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 162406242) has the molecular formula C18H30OSi and a molecular weight of 290.52 g/mol. Its IUPAC name is [(3aR,4S)-7-ethenyl-2,3,3a,4,5,6-hexahydroazulen-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,4S)-7-ethenyl-2,3,3a,4,5,6-hexahydroazulen-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 162406242 |
| Molecular Formula | C18H30OSi |
| Molecular Weight | 290.52 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | [(3aR,4S)-7-ethenyl-2,3,3a,4,5,6-hexahydroazulen-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=CC1=CC2=CCC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C18H30OSi/c1-7-14-11-12-17(16-10-8-9-15(16)13-14)19-20(5,6)18(2,3)4/h7,9,13,16-17H,1,8,10-12H2,2-6H3/t16-,17+/m1/s1 |
| InChIKey | CNIPNNSCWUJICO-SJORKVTESA-N |
| XLogP | 5.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.52 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|