C24H46OSi — CID 134982741
(1S)-1-[(1R,2E,3E)-2-hexylidene-3-(trimethylsilylmethylidene)cyclopentyl]nonan-1-ol (PubChem CID 134982741) has the molecular formula C24H46OSi and a molecular weight of 378.72 g/mol. Its IUPAC name is (1S)-1-[(1R,2E,3E)-2-hexylidene-3-(trimethylsilylmethylidene)cyclopentyl]nonan-1-ol.
| Compound Name | (1S)-1-[(1R,2E,3E)-2-hexylidene-3-(trimethylsilylmethylidene)cyclopentyl]nonan-1-ol |
|---|---|
| PubChem CID | 134982741 |
| Molecular Formula | C24H46OSi |
| Molecular Weight | 378.72 g/mol |
| Exact Mass | 378.33 |
| IUPAC Name | (1S)-1-[(1R,2E,3E)-2-hexylidene-3-(trimethylsilylmethylidene)cyclopentyl]nonan-1-ol |
| SMILES | CCCCC/C=C1C(=C/[Si](C)(C)C)/CC[C@H]/1[C@@H](O)CCCCCCCC |
| InChI | InChI=1S/C24H46OSi/c1-6-8-10-12-13-15-17-24(25)23-19-18-21(20-26(3,4)5)22(23)16-14-11-9-7-2/h16,20,23-25H,6-15,17-19H2,1-5H3/b21-20+,22-16-/t23-,24+/m1/s1 |
| InChIKey | YHDPAPINDSIAOL-ODXBVOBVSA-N |
| XLogP | 7.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.72 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|