C19H32O — CID 10492746
cis-(1S,2R)-2-[(1E,3E,5E)-3-methyltrideca-1,3,5-trienyl]cyclopentan-1-ol (PubChem CID 10492746) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is cis-(1S,2R)-2-[(1E,3E,5E)-3-methyltrideca-1,3,5-trienyl]cyclopentan-1-ol.
| Compound Name | cis-(1S,2R)-2-[(1E,3E,5E)-3-methyltrideca-1,3,5-trienyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 10492746 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | cis-(1S,2R)-2-[(1E,3E,5E)-3-methyltrideca-1,3,5-trienyl]cyclopentan-1-ol |
| SMILES | CCCCCCC/C=C/C=C(C)/C=C/[C@H]1CCC[C@@H]1O |
| InChI | InChI=1S/C19H32O/c1-3-4-5-6-7-8-9-10-12-17(2)15-16-18-13-11-14-19(18)20/h9-10,12,15-16,18-20H,3-8,11,13-14H2,1-2H3/b10-9+,16-15+,17-12+/t18-,19+/m1/s1 |
| InChIKey | YJHUFZFNOANBOW-PUSFFKQZSA-N |
| XLogP | 5.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|