C12H18O — CID 10845060
(1S,3aS,4Z,8Z,9aS)-4-methyl-2,3,3a,6,7,9a-hexahydro-1H-cyclopenta[8]annulen-1-ol (PubChem CID 10845060) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is (1S,3aS,4Z,8Z,9aS)-4-methyl-2,3,3a,6,7,9a-hexahydro-1H-cyclopenta[8]annulen-1-ol.
| Compound Name | (1S,3aS,4Z,8Z,9aS)-4-methyl-2,3,3a,6,7,9a-hexahydro-1H-cyclopenta[8]annulen-1-ol |
|---|---|
| PubChem CID | 10845060 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (1S,3aS,4Z,8Z,9aS)-4-methyl-2,3,3a,6,7,9a-hexahydro-1H-cyclopenta[8]annulen-1-ol |
| SMILES | C/C1=C/CC/C=C\[C@H]2[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C12H18O/c1-9-5-3-2-4-6-11-10(9)7-8-12(11)13/h4-6,10-13H,2-3,7-8H2,1H3/b6-4-,9-5-/t10-,11+,12+/m1/s1 |
| InChIKey | LSECZDMCSXYSRA-AAKVODCNSA-N |
| XLogP | 2.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|