C25H39FO3 — CID 145298433
[(4S,7Z,8Z)-1-[(2R,3S,5R)-3,5-dihydroxy-2-[(2Z)-octa-2,7-dienyl]cyclopentyl]-7-ethylidenedeca-1,8-dien-4-yl] hypofluorite (PubChem CID 145298433) has the molecular formula C25H39FO3 and a molecular weight of 406.58 g/mol. Its IUPAC name is [(4S,7Z,8Z)-1-[(2R,3S,5R)-3,5-dihydroxy-2-[(2Z)-octa-2,7-dienyl]cyclopentyl]-7-ethylidenedeca-1,8-dien-4-yl] hypofluorite.
| Compound Name | [(4S,7Z,8Z)-1-[(2R,3S,5R)-3,5-dihydroxy-2-[(2Z)-octa-2,7-dienyl]cyclopentyl]-7-ethylidenedeca-1,8-dien-4-yl] hypofluorite |
|---|---|
| PubChem CID | 145298433 |
| Molecular Formula | C25H39FO3 |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | [(4S,7Z,8Z)-1-[(2R,3S,5R)-3,5-dihydroxy-2-[(2Z)-octa-2,7-dienyl]cyclopentyl]-7-ethylidenedeca-1,8-dien-4-yl] hypofluorite |
| SMILES | C=CCCC/C=C\C[C@@H]1C(C=CC[C@H](CCC(/C=C\C)=C/C)OF)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C25H39FO3/c1-4-7-8-9-10-11-15-22-23(25(28)19-24(22)27)16-12-14-21(29-26)18-17-20(6-3)13-5-2/h4-6,10-13,16,21-25,27-28H,1,7-9,14-15,17-19H2,2-3H3/b11-10-,13-5-,16-12?,20-6+/t21-,22-,23?,24+,25-/m1/s1 |
| InChIKey | IUWLLFADWGBFIN-QWXOKCOFSA-N |
| XLogP | 6.17 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|