C17H32O — CID 90722146
4,8,12-trimethyltetradeca-9,11-dien-1-ol (PubChem CID 90722146) has the molecular formula C17H32O and a molecular weight of 252.44 g/mol. Its IUPAC name is 4,8,12-trimethyltetradeca-9,11-dien-1-ol.
| Compound Name | 4,8,12-trimethyltetradeca-9,11-dien-1-ol |
|---|---|
| PubChem CID | 90722146 |
| Molecular Formula | C17H32O |
| Molecular Weight | 252.44 g/mol |
| Exact Mass | 252.25 |
| IUPAC Name | 4,8,12-trimethyltetradeca-9,11-dien-1-ol |
| SMILES | CCC(C)=CC=CC(C)CCCC(C)CCCO |
| InChI | InChI=1S/C17H32O/c1-5-15(2)9-6-10-16(3)11-7-12-17(4)13-8-14-18/h6,9-10,16-18H,5,7-8,11-14H2,1-4H3 |
| InChIKey | UCZNMWJZDFCMMK-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|