C17H34OSi — CID 162404135
(4S,6S)-6,10-dimethyl-2-(trimethylsilylmethyl)undeca-1,9-dien-4-ol (PubChem CID 162404135) has the molecular formula C17H34OSi and a molecular weight of 282.54 g/mol. Its IUPAC name is (4S,6S)-6,10-dimethyl-2-(trimethylsilylmethyl)undeca-1,9-dien-4-ol.
| Compound Name | (4S,6S)-6,10-dimethyl-2-(trimethylsilylmethyl)undeca-1,9-dien-4-ol |
|---|---|
| PubChem CID | 162404135 |
| Molecular Formula | C17H34OSi |
| Molecular Weight | 282.54 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | (4S,6S)-6,10-dimethyl-2-(trimethylsilylmethyl)undeca-1,9-dien-4-ol |
| SMILES | C=C(C[C@@H](O)C[C@@H](C)CCC=C(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C17H34OSi/c1-14(2)9-8-10-15(3)11-17(18)12-16(4)13-19(5,6)7/h9,15,17-18H,4,8,10-13H2,1-3,5-7H3/t15-,17-/m0/s1 |
| InChIKey | UWRJDSTZXVVDGP-RDJZCZTQSA-N |
| XLogP | 5.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|