C19H34O2 — CID 90799998
3,9-dimethyl-6-prop-1-en-2-ylcyclotetradec-6-ene-1,4-diol (PubChem CID 90799998) has the molecular formula C19H34O2 and a molecular weight of 294.48 g/mol. Its IUPAC name is 3,9-dimethyl-6-prop-1-en-2-ylcyclotetradec-6-ene-1,4-diol.
| Compound Name | 3,9-dimethyl-6-prop-1-en-2-ylcyclotetradec-6-ene-1,4-diol |
|---|---|
| PubChem CID | 90799998 |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.26 |
| IUPAC Name | 3,9-dimethyl-6-prop-1-en-2-ylcyclotetradec-6-ene-1,4-diol |
| SMILES | C=C(C)C1=CCC(C)CCCCCC(O)CC(C)C(O)C1 |
| InChI | InChI=1S/C19H34O2/c1-14(2)17-11-10-15(3)8-6-5-7-9-18(20)12-16(4)19(21)13-17/h11,15-16,18-21H,1,5-10,12-13H2,2-4H3 |
| InChIKey | ZSMBVZDRWCVGKX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |