C22H42OSi — CID 101474218
(3E,4S,5S)-2,2-ditert-butyl-4-cyclohexyl-3-ethylidene-5-propan-2-yloxasilolane (PubChem CID 101474218) has the molecular formula C22H42OSi and a molecular weight of 350.66 g/mol. Its IUPAC name is (3E,4S,5S)-2,2-ditert-butyl-4-cyclohexyl-3-ethylidene-5-propan-2-yloxasilolane.
| Compound Name | (3E,4S,5S)-2,2-ditert-butyl-4-cyclohexyl-3-ethylidene-5-propan-2-yloxasilolane |
|---|---|
| PubChem CID | 101474218 |
| Molecular Formula | C22H42OSi |
| Molecular Weight | 350.66 g/mol |
| Exact Mass | 350.30 |
| IUPAC Name | (3E,4S,5S)-2,2-ditert-butyl-4-cyclohexyl-3-ethylidene-5-propan-2-yloxasilolane |
| SMILES | C/C=C1\[C@@H](C2CCCCC2)[C@H](C(C)C)O[Si]1(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C22H42OSi/c1-10-18-19(17-14-12-11-13-15-17)20(16(2)3)23-24(18,21(4,5)6)22(7,8)9/h10,16-17,19-20H,11-15H2,1-9H3/b18-10+/t19-,20+/m1/s1 |
| InChIKey | UKBFHJVAKJGYPU-RYOJLJCYSA-N |
| XLogP | 7.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.66 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|