C26H48OSi — CID 101168210
tert-butyl-[(E,1S,2R)-1-cyclohexyl-2-methyltridec-5-en-3-ynoxy]-dimethylsilane (PubChem CID 101168210) has the molecular formula C26H48OSi and a molecular weight of 404.76 g/mol. Its IUPAC name is tert-butyl-[(E,1S,2R)-1-cyclohexyl-2-methyltridec-5-en-3-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E,1S,2R)-1-cyclohexyl-2-methyltridec-5-en-3-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 101168210 |
| Molecular Formula | C26H48OSi |
| Molecular Weight | 404.76 g/mol |
| Exact Mass | 404.35 |
| IUPAC Name | tert-butyl-[(E,1S,2R)-1-cyclohexyl-2-methyltridec-5-en-3-ynoxy]-dimethylsilane |
| SMILES | CCCCCCC/C=C/C#C[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C26H48OSi/c1-8-9-10-11-12-13-14-15-17-20-23(2)25(24-21-18-16-19-22-24)27-28(6,7)26(3,4)5/h14-15,23-25H,8-13,16,18-19,21-22H2,1-7H3/b15-14+/t23-,25-/m1/s1 |
| InChIKey | DYDBSQKNFWBBQJ-DMVBBDTGSA-N |
| XLogP | 8.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.76 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|