C24H48OSi — CID 101474220
(3E)-4-butyl-2,2-ditert-butyl-5,5-diethyl-3-pentylideneoxasilolane (PubChem CID 101474220) has the molecular formula C24H48OSi and a molecular weight of 380.73 g/mol. Its IUPAC name is (3E)-4-butyl-2,2-ditert-butyl-5,5-diethyl-3-pentylideneoxasilolane.
| Compound Name | (3E)-4-butyl-2,2-ditert-butyl-5,5-diethyl-3-pentylideneoxasilolane |
|---|---|
| PubChem CID | 101474220 |
| Molecular Formula | C24H48OSi |
| Molecular Weight | 380.73 g/mol |
| Exact Mass | 380.35 |
| IUPAC Name | (3E)-4-butyl-2,2-ditert-butyl-5,5-diethyl-3-pentylideneoxasilolane |
| SMILES | CCCC/C=C1\C(CCCC)C(CC)(CC)O[Si]1(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C24H48OSi/c1-11-15-17-19-21-20(18-16-12-2)24(13-3,14-4)25-26(21,22(5,6)7)23(8,9)10/h19-20H,11-18H2,1-10H3/b21-19+ |
| InChIKey | VCHJGNOYKRMELE-XUTLUUPISA-N |
| XLogP | 8.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.73 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|