C18H32OSi — CID 101169026
(7R)-7-cyclohexyl-2,2,5-trimethyl-7-(2-methylprop-2-enyl)-3,6-dihydrooxasilepine (PubChem CID 101169026) has the molecular formula C18H32OSi and a molecular weight of 292.54 g/mol. Its IUPAC name is (7R)-7-cyclohexyl-2,2,5-trimethyl-7-(2-methylprop-2-enyl)-3,6-dihydrooxasilepine.
| Compound Name | (7R)-7-cyclohexyl-2,2,5-trimethyl-7-(2-methylprop-2-enyl)-3,6-dihydrooxasilepine |
|---|---|
| PubChem CID | 101169026 |
| Molecular Formula | C18H32OSi |
| Molecular Weight | 292.54 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | (7R)-7-cyclohexyl-2,2,5-trimethyl-7-(2-methylprop-2-enyl)-3,6-dihydrooxasilepine |
| SMILES | C=C(C)C[C@]1(C2CCCCC2)CC(C)=CC[Si](C)(C)O1 |
| InChI | InChI=1S/C18H32OSi/c1-15(2)13-18(17-9-7-6-8-10-17)14-16(3)11-12-20(4,5)19-18/h11,17H,1,6-10,12-14H2,2-5H3/t18-/m1/s1 |
| InChIKey | CGBOITSSQSGAEC-GOSISDBHSA-N |
| XLogP | 5.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.54 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|