C21H42OSi — CID 135062831
(E)-3-cyclohexyl-2,2-dimethyl-5-triethylsilylhept-5-en-3-ol (PubChem CID 135062831) has the molecular formula C21H42OSi and a molecular weight of 338.65 g/mol. Its IUPAC name is (E)-3-cyclohexyl-2,2-dimethyl-5-triethylsilylhept-5-en-3-ol.
| Compound Name | (E)-3-cyclohexyl-2,2-dimethyl-5-triethylsilylhept-5-en-3-ol |
|---|---|
| PubChem CID | 135062831 |
| Molecular Formula | C21H42OSi |
| Molecular Weight | 338.65 g/mol |
| Exact Mass | 338.30 |
| IUPAC Name | (E)-3-cyclohexyl-2,2-dimethyl-5-triethylsilylhept-5-en-3-ol |
| SMILES | C/C=C(\CC(O)(C1CCCCC1)C(C)(C)C)[Si](CC)(CC)CC |
| InChI | InChI=1S/C21H42OSi/c1-8-19(23(9-2,10-3)11-4)17-21(22,20(5,6)7)18-15-13-12-14-16-18/h8,18,22H,9-17H2,1-7H3/b19-8+ |
| InChIKey | AWYQEXHUHDDDEL-UFWORHAWSA-N |
| XLogP | 6.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.65 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|