C16H32OSi — CID 134980037
3-[(1S,4S)-4-tert-butyl-6-trimethylsilylcyclohex-2-en-1-yl]propan-1-ol (PubChem CID 134980037) has the molecular formula C16H32OSi and a molecular weight of 268.52 g/mol. Its IUPAC name is 3-[(1S,4S)-4-tert-butyl-6-trimethylsilylcyclohex-2-en-1-yl]propan-1-ol.
| Compound Name | 3-[(1S,4S)-4-tert-butyl-6-trimethylsilylcyclohex-2-en-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 134980037 |
| Molecular Formula | C16H32OSi |
| Molecular Weight | 268.52 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 3-[(1S,4S)-4-tert-butyl-6-trimethylsilylcyclohex-2-en-1-yl]propan-1-ol |
| SMILES | CC(C)(C)[C@@H]1C=C[C@H](CCCO)C([Si](C)(C)C)C1 |
| InChI | InChI=1S/C16H32OSi/c1-16(2,3)14-10-9-13(8-7-11-17)15(12-14)18(4,5)6/h9-10,13-15,17H,7-8,11-12H2,1-6H3/t13-,14+,15?/m0/s1 |
| InChIKey | QNKDWEZOHWDBHY-SNTRVMSOSA-N |
| XLogP | 4.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|