C27H52O2Si — CID 10717812
3-[(1R,4aR,5S,6S)-1,5,6-trimethyl-5-[2-tri(propan-2-yl)silyloxyethyl]-2,3,4,4a,6,7-hexahydronaphthalen-1-yl]propan-1-ol (PubChem CID 10717812) has the molecular formula C27H52O2Si and a molecular weight of 436.80 g/mol. Its IUPAC name is 3-[(1R,4aR,5S,6S)-1,5,6-trimethyl-5-[2-tri(propan-2-yl)silyloxyethyl]-2,3,4,4a,6,7-hexahydronaphthalen-1-yl]propan-1-ol.
| Compound Name | 3-[(1R,4aR,5S,6S)-1,5,6-trimethyl-5-[2-tri(propan-2-yl)silyloxyethyl]-2,3,4,4a,6,7-hexahydronaphthalen-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 10717812 |
| Molecular Formula | C27H52O2Si |
| Molecular Weight | 436.80 g/mol |
| Exact Mass | 436.37 |
| IUPAC Name | 3-[(1R,4aR,5S,6S)-1,5,6-trimethyl-5-[2-tri(propan-2-yl)silyloxyethyl]-2,3,4,4a,6,7-hexahydronaphthalen-1-yl]propan-1-ol |
| SMILES | CC(C)[Si](OCC[C@@]1(C)[C@@H](C)CC=C2[C@@H]1CCC[C@]2(C)CCCO)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H52O2Si/c1-20(2)30(21(3)4,22(5)6)29-19-17-27(9)23(7)13-14-24-25(27)12-10-15-26(24,8)16-11-18-28/h14,20-23,25,28H,10-13,15-19H2,1-9H3/t23-,25-,26+,27-/m0/s1 |
| InChIKey | OUYGWQRWHAHXKM-HDLKCZAISA-N |
| XLogP | 8.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.80 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|