C18H32OSi — CID 11243319
(2S)-2-[(2R,4aR,5S)-4a,8-dimethyl-5-trimethylsilyl-3,4,5,6-tetrahydro-2H-naphthalen-2-yl]propan-1-ol (PubChem CID 11243319) has the molecular formula C18H32OSi and a molecular weight of 292.54 g/mol. Its IUPAC name is (2S)-2-[(2R,4aR,5S)-4a,8-dimethyl-5-trimethylsilyl-3,4,5,6-tetrahydro-2H-naphthalen-2-yl]propan-1-ol.
| Compound Name | (2S)-2-[(2R,4aR,5S)-4a,8-dimethyl-5-trimethylsilyl-3,4,5,6-tetrahydro-2H-naphthalen-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 11243319 |
| Molecular Formula | C18H32OSi |
| Molecular Weight | 292.54 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | (2S)-2-[(2R,4aR,5S)-4a,8-dimethyl-5-trimethylsilyl-3,4,5,6-tetrahydro-2H-naphthalen-2-yl]propan-1-ol |
| SMILES | CC1=CC[C@H]([Si](C)(C)C)[C@]2(C)CC[C@@H]([C@H](C)CO)C=C12 |
| InChI | InChI=1S/C18H32OSi/c1-13-7-8-17(20(4,5)6)18(3)10-9-15(11-16(13)18)14(2)12-19/h7,11,14-15,17,19H,8-10,12H2,1-6H3/t14-,15-,17+,18-/m1/s1 |
| InChIKey | RMVPLSVZVFTCPS-XYVMCAHJSA-N |
| XLogP | 5.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|