C15H30OSi — CID 134980823
2-[(1S,4S)-4-tert-butyl-6-trimethylsilylcyclohex-2-en-1-yl]ethanol (PubChem CID 134980823) has the molecular formula C15H30OSi and a molecular weight of 254.49 g/mol. Its IUPAC name is 2-[(1S,4S)-4-tert-butyl-6-trimethylsilylcyclohex-2-en-1-yl]ethanol.
| Compound Name | 2-[(1S,4S)-4-tert-butyl-6-trimethylsilylcyclohex-2-en-1-yl]ethanol |
|---|---|
| PubChem CID | 134980823 |
| Molecular Formula | C15H30OSi |
| Molecular Weight | 254.49 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | 2-[(1S,4S)-4-tert-butyl-6-trimethylsilylcyclohex-2-en-1-yl]ethanol |
| SMILES | CC(C)(C)[C@@H]1C=C[C@H](CCO)C([Si](C)(C)C)C1 |
| InChI | InChI=1S/C15H30OSi/c1-15(2,3)13-8-7-12(9-10-16)14(11-13)17(4,5)6/h7-8,12-14,16H,9-11H2,1-6H3/t12-,13-,14?/m1/s1 |
| InChIKey | VCPDPYGCDHNGJN-ZFXTZCCVSA-N |
| XLogP | 4.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|