C20H40O2Si — CID 102518990
2-[(1R,2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dimethyl-6-propan-2-ylidenecyclohexyl]ethanol (PubChem CID 102518990) has the molecular formula C20H40O2Si and a molecular weight of 340.62 g/mol. Its IUPAC name is 2-[(1R,2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dimethyl-6-propan-2-ylidenecyclohexyl]ethanol.
| Compound Name | 2-[(1R,2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dimethyl-6-propan-2-ylidenecyclohexyl]ethanol |
|---|---|
| PubChem CID | 102518990 |
| Molecular Formula | C20H40O2Si |
| Molecular Weight | 340.62 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | 2-[(1R,2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dimethyl-6-propan-2-ylidenecyclohexyl]ethanol |
| SMILES | CC(C)=C1CC[C@@H](C)[C@@](C)(CO[Si](C)(C)C(C)(C)C)[C@@H]1CCO |
| InChI | InChI=1S/C20H40O2Si/c1-15(2)17-11-10-16(3)20(7,18(17)12-13-21)14-22-23(8,9)19(4,5)6/h16,18,21H,10-14H2,1-9H3/t16-,18-,20-/m1/s1 |
| InChIKey | BPPDCCSQZXWGGG-YVWKXTFCSA-N |
| XLogP | 5.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.62 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|