C21H40O2Si — CID 101357042
[(1R,4aS,8aS)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methanol (PubChem CID 101357042) has the molecular formula C21H40O2Si and a molecular weight of 352.64 g/mol. Its IUPAC name is [(1R,4aS,8aS)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methanol.
| Compound Name | [(1R,4aS,8aS)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methanol |
|---|---|
| PubChem CID | 101357042 |
| Molecular Formula | C21H40O2Si |
| Molecular Weight | 352.64 g/mol |
| Exact Mass | 352.28 |
| IUPAC Name | [(1R,4aS,8aS)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methanol |
| SMILES | CC1(C)CCC[C@]2(C)[C@@H](CO)C(CO[Si](C)(C)C(C)(C)C)=CC[C@@H]12 |
| InChI | InChI=1S/C21H40O2Si/c1-19(2,3)24(7,8)23-15-16-10-11-18-20(4,5)12-9-13-21(18,6)17(16)14-22/h10,17-18,22H,9,11-15H2,1-8H3/t17-,18-,21+/m0/s1 |
| InChIKey | YQXRTEASOPVLFX-BBTUJRGHSA-N |
| XLogP | 5.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.64 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|