C18H34OSi — CID 11483274
(2S)-2-[(2R,4aR,5S)-4a,8-dimethyl-5-trimethylsilyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propan-1-ol (PubChem CID 11483274) has the molecular formula C18H34OSi and a molecular weight of 294.56 g/mol. Its IUPAC name is (2S)-2-[(2R,4aR,5S)-4a,8-dimethyl-5-trimethylsilyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propan-1-ol.
| Compound Name | (2S)-2-[(2R,4aR,5S)-4a,8-dimethyl-5-trimethylsilyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 11483274 |
| Molecular Formula | C18H34OSi |
| Molecular Weight | 294.56 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | (2S)-2-[(2R,4aR,5S)-4a,8-dimethyl-5-trimethylsilyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propan-1-ol |
| SMILES | CC1=C2C[C@H]([C@H](C)CO)CC[C@@]2(C)[C@@H]([Si](C)(C)C)CC1 |
| InChI | InChI=1S/C18H34OSi/c1-13-7-8-17(20(4,5)6)18(3)10-9-15(11-16(13)18)14(2)12-19/h14-15,17,19H,7-12H2,1-6H3/t14-,15-,17+,18-/m1/s1 |
| InChIKey | XBGPFSZGVWNVJS-XYVMCAHJSA-N |
| XLogP | 5.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.56 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|