C17H32OSi — CID 11666321
(2S,4aR,5R,7S)-4a-methyl-7-propan-2-yl-5-trimethylsilyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-ol (PubChem CID 11666321) has the molecular formula C17H32OSi and a molecular weight of 280.53 g/mol. Its IUPAC name is (2S,4aR,5R,7S)-4a-methyl-7-propan-2-yl-5-trimethylsilyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-ol.
| Compound Name | (2S,4aR,5R,7S)-4a-methyl-7-propan-2-yl-5-trimethylsilyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-ol |
|---|---|
| PubChem CID | 11666321 |
| Molecular Formula | C17H32OSi |
| Molecular Weight | 280.53 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | (2S,4aR,5R,7S)-4a-methyl-7-propan-2-yl-5-trimethylsilyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-ol |
| SMILES | CC(C)[C@H]1CC2=C[C@@H](O)CC[C@@]2(C)[C@H]([Si](C)(C)C)C1 |
| InChI | InChI=1S/C17H32OSi/c1-12(2)13-9-14-11-15(18)7-8-17(14,3)16(10-13)19(4,5)6/h11-13,15-16,18H,7-10H2,1-6H3/t13-,15-,16+,17+/m0/s1 |
| InChIKey | VBWPKDOYZNYTEX-QMCVQRASSA-N |
| XLogP | 4.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|