C22H44O2Si — CID 45102243
2-[(1R,2S,6R)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1,6-dimethyl-3-propan-2-ylidenecyclohexyl]ethanol (PubChem CID 45102243) has the molecular formula C22H44O2Si and a molecular weight of 368.68 g/mol. Its IUPAC name is 2-[(1R,2S,6R)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1,6-dimethyl-3-propan-2-ylidenecyclohexyl]ethanol.
| Compound Name | 2-[(1R,2S,6R)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1,6-dimethyl-3-propan-2-ylidenecyclohexyl]ethanol |
|---|---|
| PubChem CID | 45102243 |
| Molecular Formula | C22H44O2Si |
| Molecular Weight | 368.68 g/mol |
| Exact Mass | 368.31 |
| IUPAC Name | 2-[(1R,2S,6R)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1,6-dimethyl-3-propan-2-ylidenecyclohexyl]ethanol |
| SMILES | CC(C)=C1CC[C@@H](C)[C@@](C)(CCO)[C@@H]1CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O2Si/c1-17(2)19-13-12-18(3)22(7,14-15-23)20(19)11-10-16-24-25(8,9)21(4,5)6/h18,20,23H,10-16H2,1-9H3/t18-,20-,22-/m1/s1 |
| InChIKey | PQRKTRUHOFMZBL-SYYKKAFVSA-N |
| XLogP | 6.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.68 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|