C25H48O2Si — CID 10669203
[(4aS,5R,6R,8aS)-5,6,8a-trimethyl-5-[2-tri(propan-2-yl)silyloxyethyl]-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methanol (PubChem CID 10669203) has the molecular formula C25H48O2Si and a molecular weight of 408.74 g/mol. Its IUPAC name is [(4aS,5R,6R,8aS)-5,6,8a-trimethyl-5-[2-tri(propan-2-yl)silyloxyethyl]-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methanol.
| Compound Name | [(4aS,5R,6R,8aS)-5,6,8a-trimethyl-5-[2-tri(propan-2-yl)silyloxyethyl]-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methanol |
|---|---|
| PubChem CID | 10669203 |
| Molecular Formula | C25H48O2Si |
| Molecular Weight | 408.74 g/mol |
| Exact Mass | 408.34 |
| IUPAC Name | [(4aS,5R,6R,8aS)-5,6,8a-trimethyl-5-[2-tri(propan-2-yl)silyloxyethyl]-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methanol |
| SMILES | CC(C)[Si](OCC[C@]1(C)[C@H](C)CC[C@]2(C)C(CO)=CCC[C@@H]12)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H48O2Si/c1-18(2)28(19(3)4,20(5)6)27-16-15-24(8)21(7)13-14-25(9)22(17-26)11-10-12-23(24)25/h11,18-21,23,26H,10,12-17H2,1-9H3/t21-,23+,24-,25-/m1/s1 |
| InChIKey | OWUHFYOGBSCYPI-RVFVQDDPSA-N |
| XLogP | 7.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.74 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|