C22H42OSi — CID 24997218
tert-butyl-[3-[(1S,2R,3R)-2-ethenyl-2,3-dimethyl-6-propan-2-ylidenecyclohexyl]propoxy]-dimethylsilane (PubChem CID 24997218) has the molecular formula C22H42OSi and a molecular weight of 350.66 g/mol. Its IUPAC name is tert-butyl-[3-[(1S,2R,3R)-2-ethenyl-2,3-dimethyl-6-propan-2-ylidenecyclohexyl]propoxy]-dimethylsilane.
| Compound Name | tert-butyl-[3-[(1S,2R,3R)-2-ethenyl-2,3-dimethyl-6-propan-2-ylidenecyclohexyl]propoxy]-dimethylsilane |
|---|---|
| PubChem CID | 24997218 |
| Molecular Formula | C22H42OSi |
| Molecular Weight | 350.66 g/mol |
| Exact Mass | 350.30 |
| IUPAC Name | tert-butyl-[3-[(1S,2R,3R)-2-ethenyl-2,3-dimethyl-6-propan-2-ylidenecyclohexyl]propoxy]-dimethylsilane |
| SMILES | C=C[C@]1(C)[C@H](C)CCC(=C(C)C)[C@H]1CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H42OSi/c1-11-22(8)18(4)14-15-19(17(2)3)20(22)13-12-16-23-24(9,10)21(5,6)7/h11,18,20H,1,12-16H2,2-10H3/t18-,20-,22-/m1/s1 |
| InChIKey | OWEFZSPCTUINFL-SYYKKAFVSA-N |
| XLogP | 7.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.66 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|