C23H42OSi — CID 134945478
[(3aS,5R,7aS)-7a-methyl-5-prop-1-en-2-yl-4,5,6,7-tetrahydro-1H-inden-3a-yl]methoxy-tri(propan-2-yl)silane (PubChem CID 134945478) has the molecular formula C23H42OSi and a molecular weight of 362.67 g/mol. Its IUPAC name is [(3aS,5R,7aS)-7a-methyl-5-prop-1-en-2-yl-4,5,6,7-tetrahydro-1H-inden-3a-yl]methoxy-tri(propan-2-yl)silane.
| Compound Name | [(3aS,5R,7aS)-7a-methyl-5-prop-1-en-2-yl-4,5,6,7-tetrahydro-1H-inden-3a-yl]methoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134945478 |
| Molecular Formula | C23H42OSi |
| Molecular Weight | 362.67 g/mol |
| Exact Mass | 362.30 |
| IUPAC Name | [(3aS,5R,7aS)-7a-methyl-5-prop-1-en-2-yl-4,5,6,7-tetrahydro-1H-inden-3a-yl]methoxy-tri(propan-2-yl)silane |
| SMILES | C=C(C)[C@@H]1CC[C@@]2(C)CC=C[C@@]2(CO[Si](C(C)C)(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C23H42OSi/c1-17(2)21-11-14-22(9)12-10-13-23(22,15-21)16-24-25(18(3)4,19(5)6)20(7)8/h10,13,18-21H,1,11-12,14-16H2,2-9H3/t21-,22-,23+/m1/s1 |
| InChIKey | HEGIHHLFUWNEOP-ZLNRFVROSA-N |
| XLogP | 7.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.67 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|