C28H54OSi — CID 139263604
tert-butyl-dimethyl-[(5R)-5-methyl-5-[(E)-2-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]ethenyl]non-8-enoxy]silane (PubChem CID 139263604) has the molecular formula C28H54OSi and a molecular weight of 434.83 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(5R)-5-methyl-5-[(E)-2-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]ethenyl]non-8-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(5R)-5-methyl-5-[(E)-2-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]ethenyl]non-8-enoxy]silane |
|---|---|
| PubChem CID | 139263604 |
| Molecular Formula | C28H54OSi |
| Molecular Weight | 434.83 g/mol |
| Exact Mass | 434.39 |
| IUPAC Name | tert-butyl-dimethyl-[(5R)-5-methyl-5-[(E)-2-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]ethenyl]non-8-enoxy]silane |
| SMILES | C=CCC[C@](C)(/C=C/[C@@H]1C[C@H](C)CC[C@H]1C(C)C)CCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H54OSi/c1-11-12-18-28(8,19-13-14-21-29-30(9,10)27(5,6)7)20-17-25-22-24(4)15-16-26(25)23(2)3/h11,17,20,23-26H,1,12-16,18-19,21-22H2,2-10H3/b20-17+/t24-,25-,26+,28+/m1/s1 |
| InChIKey | YSISLTGBLITOFS-YUCWIUAPSA-N |
| XLogP | 9.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.83 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|