C15H28OSi — CID 134897709
(5aS,8S)-8-tert-butyl-1,1-dimethyl-4,5,5a,8,9,9a-hexahydro-3H-2,1-benzoxasilepine (PubChem CID 134897709) has the molecular formula C15H28OSi and a molecular weight of 252.47 g/mol. Its IUPAC name is (5aS,8S)-8-tert-butyl-1,1-dimethyl-4,5,5a,8,9,9a-hexahydro-3H-2,1-benzoxasilepine.
| Compound Name | (5aS,8S)-8-tert-butyl-1,1-dimethyl-4,5,5a,8,9,9a-hexahydro-3H-2,1-benzoxasilepine |
|---|---|
| PubChem CID | 134897709 |
| Molecular Formula | C15H28OSi |
| Molecular Weight | 252.47 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | (5aS,8S)-8-tert-butyl-1,1-dimethyl-4,5,5a,8,9,9a-hexahydro-3H-2,1-benzoxasilepine |
| SMILES | CC(C)(C)[C@@H]1C=C[C@@H]2CCCO[Si](C)(C)C2C1 |
| InChI | InChI=1S/C15H28OSi/c1-15(2,3)13-9-8-12-7-6-10-16-17(4,5)14(12)11-13/h8-9,12-14H,6-7,10-11H2,1-5H3/t12-,13+,14?/m0/s1 |
| InChIKey | UDCKRYFFHHPECM-WLDKUNSKSA-N |
| XLogP | 4.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|