C14H26OSi — CID 134889310
(4aS,7S)-7-tert-butyl-1,1-dimethyl-3,4,4a,7,8,8a-hexahydro-2,1-benzoxasiline (PubChem CID 134889310) has the molecular formula C14H26OSi and a molecular weight of 238.45 g/mol. Its IUPAC name is (4aS,7S)-7-tert-butyl-1,1-dimethyl-3,4,4a,7,8,8a-hexahydro-2,1-benzoxasiline.
| Compound Name | (4aS,7S)-7-tert-butyl-1,1-dimethyl-3,4,4a,7,8,8a-hexahydro-2,1-benzoxasiline |
|---|---|
| PubChem CID | 134889310 |
| Molecular Formula | C14H26OSi |
| Molecular Weight | 238.45 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | (4aS,7S)-7-tert-butyl-1,1-dimethyl-3,4,4a,7,8,8a-hexahydro-2,1-benzoxasiline |
| SMILES | CC(C)(C)[C@@H]1C=C[C@@H]2CCO[Si](C)(C)C2C1 |
| InChI | InChI=1S/C14H26OSi/c1-14(2,3)12-7-6-11-8-9-15-16(4,5)13(11)10-12/h6-7,11-13H,8-10H2,1-5H3/t11-,12-,13?/m1/s1 |
| InChIKey | YKFTZGLHKBHQEQ-ZNRZSNADSA-N |
| XLogP | 4.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|