C11H20OSi — CID 134889402
(4aS,7S)-1,1,7-trimethyl-3,4,4a,7,8,8a-hexahydro-2,1-benzoxasiline (PubChem CID 134889402) has the molecular formula C11H20OSi and a molecular weight of 196.37 g/mol. Its IUPAC name is (4aS,7S)-1,1,7-trimethyl-3,4,4a,7,8,8a-hexahydro-2,1-benzoxasiline.
| Compound Name | (4aS,7S)-1,1,7-trimethyl-3,4,4a,7,8,8a-hexahydro-2,1-benzoxasiline |
|---|---|
| PubChem CID | 134889402 |
| Molecular Formula | C11H20OSi |
| Molecular Weight | 196.37 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | (4aS,7S)-1,1,7-trimethyl-3,4,4a,7,8,8a-hexahydro-2,1-benzoxasiline |
| SMILES | C[C@@H]1C=C[C@@H]2CCO[Si](C)(C)C2C1 |
| InChI | InChI=1S/C11H20OSi/c1-9-4-5-10-6-7-12-13(2,3)11(10)8-9/h4-5,9-11H,6-8H2,1-3H3/t9-,10-,11?/m1/s1 |
| InChIKey | MXCLUNKGPORYHJ-DIOIDXFWSA-N |
| XLogP | 3.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|