C12H22OSi — CID 134889206
(5aS,8S)-1,1,8-trimethyl-4,5,5a,8,9,9a-hexahydro-3H-2,1-benzoxasilepine (PubChem CID 134889206) has the molecular formula C12H22OSi and a molecular weight of 210.39 g/mol. Its IUPAC name is (5aS,8S)-1,1,8-trimethyl-4,5,5a,8,9,9a-hexahydro-3H-2,1-benzoxasilepine.
| Compound Name | (5aS,8S)-1,1,8-trimethyl-4,5,5a,8,9,9a-hexahydro-3H-2,1-benzoxasilepine |
|---|---|
| PubChem CID | 134889206 |
| Molecular Formula | C12H22OSi |
| Molecular Weight | 210.39 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (5aS,8S)-1,1,8-trimethyl-4,5,5a,8,9,9a-hexahydro-3H-2,1-benzoxasilepine |
| SMILES | C[C@@H]1C=C[C@@H]2CCCO[Si](C)(C)C2C1 |
| InChI | InChI=1S/C12H22OSi/c1-10-6-7-11-5-4-8-13-14(2,3)12(11)9-10/h6-7,10-12H,4-5,8-9H2,1-3H3/t10-,11+,12?/m1/s1 |
| InChIKey | SBYAIIVUOPOBIC-UBNQGINQSA-N |
| XLogP | 3.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|