C18H36OSi — CID 57332271
tert-butyl-[(E)-5-cycloheptylpent-4-enoxy]-dimethylsilane (PubChem CID 57332271) has the molecular formula C18H36OSi and a molecular weight of 296.57 g/mol. Its IUPAC name is tert-butyl-[(E)-5-cycloheptylpent-4-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-5-cycloheptylpent-4-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 57332271 |
| Molecular Formula | C18H36OSi |
| Molecular Weight | 296.57 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | tert-butyl-[(E)-5-cycloheptylpent-4-enoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCC/C=C/C1CCCCCC1 |
| InChI | InChI=1S/C18H36OSi/c1-18(2,3)20(4,5)19-16-12-8-11-15-17-13-9-6-7-10-14-17/h11,15,17H,6-10,12-14,16H2,1-5H3/b15-11+ |
| InChIKey | NWLVCKVFGPWVDD-RVDMUPIBSA-N |
| XLogP | 6.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.57 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|