C24H50OSi — CID 146679946
tert-butyl-dimethyl-[(E,13S)-13-methylheptadec-10-enoxy]silane (PubChem CID 146679946) has the molecular formula C24H50OSi and a molecular weight of 382.75 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E,13S)-13-methylheptadec-10-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(E,13S)-13-methylheptadec-10-enoxy]silane |
|---|---|
| PubChem CID | 146679946 |
| Molecular Formula | C24H50OSi |
| Molecular Weight | 382.75 g/mol |
| Exact Mass | 382.36 |
| IUPAC Name | tert-butyl-dimethyl-[(E,13S)-13-methylheptadec-10-enoxy]silane |
| SMILES | CCCC[C@H](C)C/C=C/CCCCCCCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H50OSi/c1-8-9-20-23(2)21-18-16-14-12-10-11-13-15-17-19-22-25-26(6,7)24(3,4)5/h16,18,23H,8-15,17,19-22H2,1-7H3/b18-16+/t23-/m0/s1 |
| InChIKey | KFGZNDYFXIHIMF-NGIFANIDSA-N |
| XLogP | 8.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.75 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|