C26H54OSi — CID 91697215
tert-butyl-dimethyl-[(Z)-3,7,11,15-tetramethylhexadec-2-enoxy]silane (PubChem CID 91697215) has the molecular formula C26H54OSi and a molecular weight of 410.80 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(Z)-3,7,11,15-tetramethylhexadec-2-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(Z)-3,7,11,15-tetramethylhexadec-2-enoxy]silane |
|---|---|
| PubChem CID | 91697215 |
| Molecular Formula | C26H54OSi |
| Molecular Weight | 410.80 g/mol |
| Exact Mass | 410.39 |
| IUPAC Name | tert-butyl-dimethyl-[(Z)-3,7,11,15-tetramethylhexadec-2-enoxy]silane |
| SMILES | C/C(=C/CO[Si](C)(C)C(C)(C)C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C26H54OSi/c1-22(2)14-11-15-23(3)16-12-17-24(4)18-13-19-25(5)20-21-27-28(9,10)26(6,7)8/h20,22-24H,11-19,21H2,1-10H3/b25-20- |
| InChIKey | XACKPGHSEBHHTQ-QQTULTPQSA-N |
| XLogP | 9.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.80 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|