C11H20OSi — CID 134900840
1,1-dimethyl-4,5,5a,8,9,9a-hexahydro-3H-2,1-benzoxasilepine (PubChem CID 134900840) has the molecular formula C11H20OSi and a molecular weight of 196.37 g/mol. Its IUPAC name is 1,1-dimethyl-4,5,5a,8,9,9a-hexahydro-3H-2,1-benzoxasilepine.
| Compound Name | 1,1-dimethyl-4,5,5a,8,9,9a-hexahydro-3H-2,1-benzoxasilepine |
|---|---|
| PubChem CID | 134900840 |
| Molecular Formula | C11H20OSi |
| Molecular Weight | 196.37 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 1,1-dimethyl-4,5,5a,8,9,9a-hexahydro-3H-2,1-benzoxasilepine |
| SMILES | C[Si]1(C)OCCCC2C=CCCC21 |
| InChI | InChI=1S/C11H20OSi/c1-13(2)11-8-4-3-6-10(11)7-5-9-12-13/h3,6,10-11H,4-5,7-9H2,1-2H3 |
| InChIKey | NKPUGXGCAIWMSS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|