C10H18OSi — CID 134889240
1,1-dimethyl-3,4,4a,7,8,8a-hexahydro-2,1-benzoxasiline (PubChem CID 134889240) has the molecular formula C10H18OSi and a molecular weight of 182.34 g/mol. Its IUPAC name is 1,1-dimethyl-3,4,4a,7,8,8a-hexahydro-2,1-benzoxasiline.
| Compound Name | 1,1-dimethyl-3,4,4a,7,8,8a-hexahydro-2,1-benzoxasiline |
|---|---|
| PubChem CID | 134889240 |
| Molecular Formula | C10H18OSi |
| Molecular Weight | 182.34 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 1,1-dimethyl-3,4,4a,7,8,8a-hexahydro-2,1-benzoxasiline |
| SMILES | C[Si]1(C)OCCC2C=CCCC21 |
| InChI | InChI=1S/C10H18OSi/c1-12(2)10-6-4-3-5-9(10)7-8-11-12/h3,5,9-10H,4,6-8H2,1-2H3 |
| InChIKey | SCTRWPNAVZRKKC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|