C15H28OSi — CID 14492051
dimethyl-[(2R)-2-[(1R)-4-methylcyclohex-3-en-1-yl]propoxy]-prop-2-enylsilane (PubChem CID 14492051) has the molecular formula C15H28OSi and a molecular weight of 252.47 g/mol. Its IUPAC name is dimethyl-[(2R)-2-[(1R)-4-methylcyclohex-3-en-1-yl]propoxy]-prop-2-enylsilane.
| Compound Name | dimethyl-[(2R)-2-[(1R)-4-methylcyclohex-3-en-1-yl]propoxy]-prop-2-enylsilane |
|---|---|
| PubChem CID | 14492051 |
| Molecular Formula | C15H28OSi |
| Molecular Weight | 252.47 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | dimethyl-[(2R)-2-[(1R)-4-methylcyclohex-3-en-1-yl]propoxy]-prop-2-enylsilane |
| SMILES | C=CC[Si](C)(C)OC[C@H](C)[C@H]1CC=C(C)CC1 |
| InChI | InChI=1S/C15H28OSi/c1-6-11-17(4,5)16-12-14(3)15-9-7-13(2)8-10-15/h6-7,14-15H,1,8-12H2,2-5H3/t14-,15-/m0/s1 |
| InChIKey | ZUSQHSAPYGNUBN-GJZGRUSLSA-N |
| XLogP | 4.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|