C13H24OSi — CID 134889222
(3aR,6S)-6-tert-butyl-1,1-dimethyl-3a,6,7,7a-tetrahydro-3H-2,1-benzoxasilole (PubChem CID 134889222) has the molecular formula C13H24OSi and a molecular weight of 224.42 g/mol. Its IUPAC name is (3aR,6S)-6-tert-butyl-1,1-dimethyl-3a,6,7,7a-tetrahydro-3H-2,1-benzoxasilole.
| Compound Name | (3aR,6S)-6-tert-butyl-1,1-dimethyl-3a,6,7,7a-tetrahydro-3H-2,1-benzoxasilole |
|---|---|
| PubChem CID | 134889222 |
| Molecular Formula | C13H24OSi |
| Molecular Weight | 224.42 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | (3aR,6S)-6-tert-butyl-1,1-dimethyl-3a,6,7,7a-tetrahydro-3H-2,1-benzoxasilole |
| SMILES | CC(C)(C)[C@@H]1C=C[C@@H]2CO[Si](C)(C)C2C1 |
| InChI | InChI=1S/C13H24OSi/c1-13(2,3)11-7-6-10-9-14-15(4,5)12(10)8-11/h6-7,10-12H,8-9H2,1-5H3/t10-,11-,12?/m1/s1 |
| InChIKey | FRWSQDUDPXDOON-XFKKCKKNSA-N |
| XLogP | 3.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|