C10H18OSi — CID 134861110
(3aR,7aR)-1,1,6-trimethyl-3a,6,7,7a-tetrahydro-3H-2,1-benzoxasilole (PubChem CID 134861110) has the molecular formula C10H18OSi and a molecular weight of 182.34 g/mol. Its IUPAC name is (3aR,7aR)-1,1,6-trimethyl-3a,6,7,7a-tetrahydro-3H-2,1-benzoxasilole.
| Compound Name | (3aR,7aR)-1,1,6-trimethyl-3a,6,7,7a-tetrahydro-3H-2,1-benzoxasilole |
|---|---|
| PubChem CID | 134861110 |
| Molecular Formula | C10H18OSi |
| Molecular Weight | 182.34 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (3aR,7aR)-1,1,6-trimethyl-3a,6,7,7a-tetrahydro-3H-2,1-benzoxasilole |
| SMILES | CC1C=C[C@@H]2CO[Si](C)(C)[C@@H]2C1 |
| InChI | InChI=1S/C10H18OSi/c1-8-4-5-9-7-11-12(2,3)10(9)6-8/h4-5,8-10H,6-7H2,1-3H3/t8?,9-,10-/m1/s1 |
| InChIKey | JOKYOATZEUOUPL-VXRWAFEHSA-N |
| XLogP | 2.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|