C18H32OSi — CID 53493823
(E,2S)-2-pent-4-enyl-2-(2-trimethylsilylethynyl)oct-6-en-1-ol (PubChem CID 53493823) has the molecular formula C18H32OSi and a molecular weight of 292.54 g/mol. Its IUPAC name is (E,2S)-2-pent-4-enyl-2-(2-trimethylsilylethynyl)oct-6-en-1-ol.
| Compound Name | (E,2S)-2-pent-4-enyl-2-(2-trimethylsilylethynyl)oct-6-en-1-ol |
|---|---|
| PubChem CID | 53493823 |
| Molecular Formula | C18H32OSi |
| Molecular Weight | 292.54 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | (E,2S)-2-pent-4-enyl-2-(2-trimethylsilylethynyl)oct-6-en-1-ol |
| SMILES | C=CCCC[C@](C#C[Si](C)(C)C)(CO)CCC/C=C/C |
| InChI | InChI=1S/C18H32OSi/c1-6-8-10-12-14-18(17-19,13-11-9-7-2)15-16-20(3,4)5/h6-8,19H,2,9-14,17H2,1,3-5H3/b8-6+/t18-/m0/s1 |
| InChIKey | ATBGAMKPWOZPOF-IWHGQQBYSA-N |
| XLogP | 4.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|