C17H30OSi — CID 10755091
4,6,6-trimethyl-5-(5-trimethylsilylpent-3-ynyl)cyclohex-3-en-1-ol (PubChem CID 10755091) has the molecular formula C17H30OSi and a molecular weight of 278.51 g/mol. Its IUPAC name is 4,6,6-trimethyl-5-(5-trimethylsilylpent-3-ynyl)cyclohex-3-en-1-ol.
| Compound Name | 4,6,6-trimethyl-5-(5-trimethylsilylpent-3-ynyl)cyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 10755091 |
| Molecular Formula | C17H30OSi |
| Molecular Weight | 278.51 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 4,6,6-trimethyl-5-(5-trimethylsilylpent-3-ynyl)cyclohex-3-en-1-ol |
| SMILES | CC1=CCC(O)C(C)(C)C1CCC#CC[Si](C)(C)C |
| InChI | InChI=1S/C17H30OSi/c1-14-11-12-16(18)17(2,3)15(14)10-8-7-9-13-19(4,5)6/h11,15-16,18H,8,10,12-13H2,1-6H3 |
| InChIKey | XRPYFHFAQYNRJE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|