C17H32OSi — CID 101455155
(3R)-3-[(1S,4R)-4-ethenyl-1-methyl-2-(trimethylsilylmethyl)cyclohex-2-en-1-yl]butan-1-ol (PubChem CID 101455155) has the molecular formula C17H32OSi and a molecular weight of 280.53 g/mol. Its IUPAC name is (3R)-3-[(1S,4R)-4-ethenyl-1-methyl-2-(trimethylsilylmethyl)cyclohex-2-en-1-yl]butan-1-ol.
| Compound Name | (3R)-3-[(1S,4R)-4-ethenyl-1-methyl-2-(trimethylsilylmethyl)cyclohex-2-en-1-yl]butan-1-ol |
|---|---|
| PubChem CID | 101455155 |
| Molecular Formula | C17H32OSi |
| Molecular Weight | 280.53 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | (3R)-3-[(1S,4R)-4-ethenyl-1-methyl-2-(trimethylsilylmethyl)cyclohex-2-en-1-yl]butan-1-ol |
| SMILES | C=C[C@@H]1C=C(C[Si](C)(C)C)[C@](C)([C@H](C)CCO)CC1 |
| InChI | InChI=1S/C17H32OSi/c1-7-15-8-10-17(3,14(2)9-11-18)16(12-15)13-19(4,5)6/h7,12,14-15,18H,1,8-11,13H2,2-6H3/t14-,15+,17+/m1/s1 |
| InChIKey | RNOFVFMUSJOKCT-VYDXJSESSA-N |
| XLogP | 4.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|