C20H38OSi — CID 11834257
tert-butyl-dimethyl-[5-methyl-4-(6-methylhept-5-en-2-yl)cyclopenten-1-yl]oxysilane (PubChem CID 11834257) has the molecular formula C20H38OSi and a molecular weight of 322.61 g/mol. Its IUPAC name is tert-butyl-dimethyl-[5-methyl-4-(6-methylhept-5-en-2-yl)cyclopenten-1-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[5-methyl-4-(6-methylhept-5-en-2-yl)cyclopenten-1-yl]oxysilane |
|---|---|
| PubChem CID | 11834257 |
| Molecular Formula | C20H38OSi |
| Molecular Weight | 322.61 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | tert-butyl-dimethyl-[5-methyl-4-(6-methylhept-5-en-2-yl)cyclopenten-1-yl]oxysilane |
| SMILES | CC(C)=CCCC(C)C1CC=C(O[Si](C)(C)C(C)(C)C)C1C |
| InChI | InChI=1S/C20H38OSi/c1-15(2)11-10-12-16(3)18-13-14-19(17(18)4)21-22(8,9)20(5,6)7/h11,14,16-18H,10,12-13H2,1-9H3 |
| InChIKey | RITFQHTYWNDZIS-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.61 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|