C24H44OSi — CID 16732642
tert-butyl-[(4S,6S)-5,5-dimethyl-4,6-bis(3-methylbut-2-enyl)cyclohexen-1-yl]oxy-dimethylsilane (PubChem CID 16732642) has the molecular formula C24H44OSi and a molecular weight of 376.70 g/mol. Its IUPAC name is tert-butyl-[(4S,6S)-5,5-dimethyl-4,6-bis(3-methylbut-2-enyl)cyclohexen-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(4S,6S)-5,5-dimethyl-4,6-bis(3-methylbut-2-enyl)cyclohexen-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 16732642 |
| Molecular Formula | C24H44OSi |
| Molecular Weight | 376.70 g/mol |
| Exact Mass | 376.32 |
| IUPAC Name | tert-butyl-[(4S,6S)-5,5-dimethyl-4,6-bis(3-methylbut-2-enyl)cyclohexen-1-yl]oxy-dimethylsilane |
| SMILES | CC(C)=CC[C@H]1CC=C(O[Si](C)(C)C(C)(C)C)[C@@H](CC=C(C)C)C1(C)C |
| InChI | InChI=1S/C24H44OSi/c1-18(2)12-14-20-15-17-22(25-26(10,11)23(5,6)7)21(24(20,8)9)16-13-19(3)4/h12-13,17,20-21H,14-16H2,1-11H3/t20-,21+/m0/s1 |
| InChIKey | FNLQBKUDBVWKAA-LEWJYISDSA-N |
| XLogP | 8.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.70 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|