C24H49BO2Si — CID 13228834
tert-butyl-[(Z,1R)-1-cyclohexyl-2-dibutylboranyloxybut-2-enoxy]-dimethylsilane (PubChem CID 13228834) has the molecular formula C24H49BO2Si and a molecular weight of 408.55 g/mol. Its IUPAC name is tert-butyl-[(Z,1R)-1-cyclohexyl-2-dibutylboranyloxybut-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z,1R)-1-cyclohexyl-2-dibutylboranyloxybut-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 13228834 |
| Molecular Formula | C24H49BO2Si |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.36 |
| IUPAC Name | tert-butyl-[(Z,1R)-1-cyclohexyl-2-dibutylboranyloxybut-2-enoxy]-dimethylsilane |
| SMILES | C/C=C(\OB(CCCC)CCCC)[C@H](O[Si](C)(C)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C24H49BO2Si/c1-9-12-19-25(20-13-10-2)26-22(11-3)23(21-17-15-14-16-18-21)27-28(7,8)24(4,5)6/h11,21,23H,9-10,12-20H2,1-8H3/b22-11-/t23-/m1/s1 |
| InChIKey | HGMANWBRXMOUHG-SOMWRMJPSA-N |
| XLogP | 8.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|