C19H34O2SSi — CID 15195654
[(4aS,5S)-9-(methylsulfanylmethoxy)-2,3,4,4a,5,8-hexahydro-1H-benzo[7]annulen-5-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 15195654) has the molecular formula C19H34O2SSi and a molecular weight of 354.63 g/mol. Its IUPAC name is [(4aS,5S)-9-(methylsulfanylmethoxy)-2,3,4,4a,5,8-hexahydro-1H-benzo[7]annulen-5-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(4aS,5S)-9-(methylsulfanylmethoxy)-2,3,4,4a,5,8-hexahydro-1H-benzo[7]annulen-5-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 15195654 |
| Molecular Formula | C19H34O2SSi |
| Molecular Weight | 354.63 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | [(4aS,5S)-9-(methylsulfanylmethoxy)-2,3,4,4a,5,8-hexahydro-1H-benzo[7]annulen-5-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CSCOC1=C2CCCC[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)C=CC1 |
| InChI | InChI=1S/C19H34O2SSi/c1-19(2,3)23(5,6)21-18-13-9-12-17(20-14-22-4)15-10-7-8-11-16(15)18/h9,13,16,18H,7-8,10-12,14H2,1-6H3/t16-,18-/m0/s1 |
| InChIKey | QLFDWNWXNIQLJI-WMZOPIPTSA-N |
| XLogP | 6.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.63 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|