C23H46O3Si — CID 16680394
(E,4S)-4-[(2S,3S,6S)-3-methyl-6-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]oxan-2-yl]pent-2-en-1-ol (PubChem CID 16680394) has the molecular formula C23H46O3Si and a molecular weight of 398.70 g/mol. Its IUPAC name is (E,4S)-4-[(2S,3S,6S)-3-methyl-6-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]oxan-2-yl]pent-2-en-1-ol.
| Compound Name | (E,4S)-4-[(2S,3S,6S)-3-methyl-6-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]oxan-2-yl]pent-2-en-1-ol |
|---|---|
| PubChem CID | 16680394 |
| Molecular Formula | C23H46O3Si |
| Molecular Weight | 398.70 g/mol |
| Exact Mass | 398.32 |
| IUPAC Name | (E,4S)-4-[(2S,3S,6S)-3-methyl-6-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]oxan-2-yl]pent-2-en-1-ol |
| SMILES | CC(C)[Si](OC[C@@H](C)[C@@H]1CC[C@H](C)[C@@H]([C@@H](C)/C=C/CO)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H46O3Si/c1-16(2)27(17(3)4,18(5)6)25-15-21(9)22-13-12-20(8)23(26-22)19(7)11-10-14-24/h10-11,16-24H,12-15H2,1-9H3/b11-10+/t19-,20-,21+,22-,23+/m0/s1 |
| InChIKey | QVHKWVJFVZVSTL-BVYQWZDTSA-N |
| XLogP | 6.18 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.70 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|