C31H56O3Si — CID 166443981
(E,3R,5R,9R)-11-[(2S,3R,4R,5R,6S)-6-ethynyl-3,5-dimethyl-4-triethylsilyloxyoxan-2-yl]-3,5,7,9-tetramethyl-2-methylideneundec-7-en-1-ol (PubChem CID 166443981) has the molecular formula C31H56O3Si and a molecular weight of 504.87 g/mol. Its IUPAC name is (E,3R,5R,9R)-11-[(2S,3R,4R,5R,6S)-6-ethynyl-3,5-dimethyl-4-triethylsilyloxyoxan-2-yl]-3,5,7,9-tetramethyl-2-methylideneundec-7-en-1-ol.
| Compound Name | (E,3R,5R,9R)-11-[(2S,3R,4R,5R,6S)-6-ethynyl-3,5-dimethyl-4-triethylsilyloxyoxan-2-yl]-3,5,7,9-tetramethyl-2-methylideneundec-7-en-1-ol |
|---|---|
| PubChem CID | 166443981 |
| Molecular Formula | C31H56O3Si |
| Molecular Weight | 504.87 g/mol |
| Exact Mass | 504.40 |
| IUPAC Name | (E,3R,5R,9R)-11-[(2S,3R,4R,5R,6S)-6-ethynyl-3,5-dimethyl-4-triethylsilyloxyoxan-2-yl]-3,5,7,9-tetramethyl-2-methylideneundec-7-en-1-ol |
| SMILES | C#C[C@H]1O[C@@H](CC[C@@H](C)/C=C(\C)C[C@H](C)C[C@@H](C)C(=C)CO)[C@@H](C)[C@@H](O[Si](CC)(CC)CC)[C@@H]1C |
| InChI | InChI=1S/C31H56O3Si/c1-12-29-27(10)31(34-35(13-2,14-3)15-4)28(11)30(33-29)17-16-22(5)18-23(6)19-24(7)20-25(8)26(9)21-32/h1,18,22,24-25,27-32H,9,13-17,19-21H2,2-8,10-11H3/b23-18+/t22-,24+,25-,27-,28-,29-,30+,31+/m1/s1 |
| InChIKey | NINPWDNNXPSKCE-HWKGUJBGSA-N |
| XLogP | 8.01 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.87 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|